Silicone oil M 1000, 10 kg

Silicone Oil M 1000 is a documented reagent with the molecular formula Si(CH3)2O(CH3SiO)x(OCH3)y, where x ranges from 70 to 90 and y ranges from 10 to 30. This silicon-based oil has a molecular weight between 1000 and 1200 g/mol. It belongs to the class of polysiloxanes, characterized by alternating silicon and oxygen atoms with organic side groups. This specific Silicone Oil M 1000 is offered as a high-purity grade, packaged in 10 kg containers. Its primary application lies in various industrial processes due to its low viscosity and excellent thermal stability. Additionally, it exhibits good electrical insulating properties and resistance to oxidation.

• CAS Number: 63148-62-9