Silicone oil M 250 000, 1 kg

Silicone Oil M 250 000 is a professionally handled substance with documented safety properties. It belongs to the siloxane family, with a molecular formula of Si(OCH3)2(OCH3)2(OSi(OCH3)2)n, where n represents the number of repeating units. This oil has a high molecular weight of approximately 250 000 g/mol. Its primary function is as a viscosity modifier in various industrial applications, such as lubricants, cosmetics, and adhesives. This specific Silicone Oil M 250 000 is offered in a 1 kg pack size, ensuring consistent quality and purity Additionally, it exhibits excellent thermal stability and low volatility, making it suitable for high-temperature applications.

• CAS Number: 63148-62-9