Silicone oil M 20, 10 kg

Silicone Oil M 20 is applied in various analytical and synthetic procedures due to its unique properties. This viscous liquid, identified as a silicon-based oil, has a molecular formula of Si(CH3)2O(CH3SiO)nSi(CH3)3 where n ranges from 1 to 10. Its molecular weight varies depending on the number of repeating units, typically ranging between 280 and 2800 g/mol. This compound belongs to the class of polydimethylsiloxanes, known for their flexible and non-reactive nature. It is often used as a lubricant, release agent, or surfactant in a wide range of industries. This specific Silicone Oil M 20 is supplied in a 10 kg pack, ensuring ample quantity for extensive applications. Additionally, it exhibits low volatility and high thermal stability, making it suitable for high-temperature processes.

• CAS Number: 63148-62-9