Bis(4-Nitrophenyl)phosphoric acid sodium, 5 g

Bis(4-Nitrophenyl)Phosphoric Acid Sodium is a documented reagent featuring a molecular formula of C12H8N2NaO8P and a molecular weight of 362.16. This compound belongs to the class of organic compounds containing nitro groups and phosphate esters. It is offered in a 5 gram pack size, making it suitable for various laboratory applications. Bis(4-Nitrophenyl)Phosphoric Acid Sodium is known for its ability to act as a catalyst in certain reactions due to its unique structure. Additionally, it may find utility in analytical chemistry due to its characteristic absorption spectrum.

• CAS Number: 4043-96-3
• Exact Mass: 361.99159650
• Molecular Weight: 362.16
• Molecular Formula: C12H8N2NaO8P